C15H16F3N3O2 — CID 156847135
2-(5-cyclopropyl-8-methyl-3-oxa-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-10-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 156847135) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-(5-cyclopropyl-8-methyl-3-oxa-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-10-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(5-cyclopropyl-8-methyl-3-oxa-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-10-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 156847135 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(5-cyclopropyl-8-methyl-3-oxa-4,9,11-triazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraen-10-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CC1Cc2c(C3CC3)noc2-c2cnc(C(C)(O)C(F)(F)F)n21 |
| InChI | InChI=1S/C15H16F3N3O2/c1-7-5-9-11(8-3-4-8)20-23-12(9)10-6-19-13(21(7)10)14(2,22)15(16,17)18/h6-8,22H,3-5H2,1-2H3 |
| InChIKey | XFCYJNYAUYJGCJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |