About 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate
2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate (PubChem CID 156849693) has the molecular formula C27H21FN2O2
and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate.
Molecular Properties
| Compound Name | 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate |
| PubChem CID | 156849693 |
| Molecular Formula | C27H21FN2O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate |
| SMILES | COC(=O)c1cc(N)ccc1-c1ccccc1.N#Cc1cc(-c2ccccc2)ccc1F |
| InChI | InChI=1S/C14H13NO2.C13H8FN/c1-17-14(16)13-9-11(15)7-8-12(13)10-5-3-2-4-6-10;14-13-7-6-11(8-12(13)9-15)10-4-2-1-3-5-10/h2-9H,15H2,1H3;1-8H |
| InChIKey | DNNGQHMAXFEBBN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate?
The IUPAC name of 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate (CID 156849693) is 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate.
What is the SMILES notation for 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate?
The canonical SMILES for 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate is COC(=O)c1cc(N)ccc1-c1ccccc1.N#Cc1cc(-c2ccccc2)ccc1F.
What is the InChIKey of 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate?
The InChIKey is DNNGQHMAXFEBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2.C13H8FN/c1-17-14(16)13-9-11(15)7-8-12(13)10-5-3-2-4-6-10;14-13-7-6-11(8-12(13)9-15)10-4-2-1-3-5-10/h2-9H,15H2,1H3;1-8H.
What are the key properties of 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate?
2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate has a molecular weight of 424.48 g/mol, XLogP of 6.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-phenylbenzonitrile;methyl 5-amino-2-phenylbenzoate is sourced from PubChem (CID 156849693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).