C18H31NO2Si — CID 15685049
[(3R,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 15685049) has the molecular formula C18H31NO2Si and a molecular weight of 321.54 g/mol. Its IUPAC name is [(3R,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15685049 |
| Molecular Formula | C18H31NO2Si |
| Molecular Weight | 321.54 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | [(3R,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C18H31NO2Si/c1-7-16-13-17(21-22(5,6)18(2,3)4)20-19(16)14-15-11-9-8-10-12-15/h8-12,16-17H,7,13-14H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | KFILPRYUFMNTTF-IAGOWNOFSA-N |
| XLogP | 4.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|