C20H27NO3 — CID 156854026
2-(diethylamino)ethyl 3-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 156854026) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | 2-(diethylamino)ethyl 3-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 156854026 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-(diethylamino)ethyl 3-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | CCN(CC)CCOC(=O)CCc1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C20H27NO3/c1-4-21(5-2)12-13-24-20(22)11-7-16-6-8-18-15-19(23-3)10-9-17(18)14-16/h6,8-10,14-15H,4-5,7,11-13H2,1-3H3 |
| InChIKey | DRBPWKKSQSMMDD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |