C17H12ClN3O — CID 156854996
2-benzoyl-7-chloro-3-ethylimidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 156854996) has the molecular formula C17H12ClN3O and a molecular weight of 309.76 g/mol. Its IUPAC name is 2-benzoyl-7-chloro-3-ethylimidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 2-benzoyl-7-chloro-3-ethylimidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 156854996 |
| Molecular Formula | C17H12ClN3O |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-benzoyl-7-chloro-3-ethylimidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | CCc1c(C(=O)c2ccccc2)nc2cc(Cl)c(C#N)cn12 |
| InChI | InChI=1S/C17H12ClN3O/c1-2-14-16(17(22)11-6-4-3-5-7-11)20-15-8-13(18)12(9-19)10-21(14)15/h3-8,10H,2H2,1H3 |
| InChIKey | VVSAAAOWTBIDCL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |