C25H25N4O2+ — CID 156857483
4-[4-amino-3-methyl-5-(4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl]cyclohexan-1-one (PubChem CID 156857483) has the molecular formula C25H25N4O2+ and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-[4-amino-3-methyl-5-(4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl]cyclohexan-1-one.
| Compound Name | 4-[4-amino-3-methyl-5-(4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 156857483 |
| Molecular Formula | C25H25N4O2+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 4-[4-amino-3-methyl-5-(4-phenoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl]cyclohexan-1-one |
| SMILES | C[n+]1cnn2c(C3CCC(=O)CC3)cc(-c3ccc(Oc4ccccc4)cc3)c2c1N |
| InChI | InChI=1S/C25H24N4O2/c1-28-16-27-29-23(18-7-11-19(30)12-8-18)15-22(24(29)25(28)26)17-9-13-21(14-10-17)31-20-5-3-2-4-6-20/h2-6,9-10,13-16,18,26H,7-8,11-12H2,1H3/p+1 |
| InChIKey | OLYSPQBXJDKGTQ-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|