C22H24N4O — CID 150345252
2-cyclohexyl-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 150345252) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-cyclohexyl-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-cyclohexyl-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 150345252 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-cyclohexyl-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1nc(C2CCCCC2)nc(N)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N4O/c23-20-19(21(24)26-22(25-20)16-7-3-1-4-8-16)15-11-13-18(14-12-15)27-17-9-5-2-6-10-17/h2,5-6,9-14,16H,1,3-4,7-8H2,(H4,23,24,25,26) |
| InChIKey | GSOGZBMNDZZDPN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |