C24H23N3OS — CID 177157791
7-cyclohexyl-5-(4-phenoxyphenyl)thieno[3,4-d]pyrimidin-4-amine (PubChem CID 177157791) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 7-cyclohexyl-5-(4-phenoxyphenyl)thieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 7-cyclohexyl-5-(4-phenoxyphenyl)thieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 177157791 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 7-cyclohexyl-5-(4-phenoxyphenyl)thieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c(C3CCCCC3)sc(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C24H23N3OS/c25-24-20-21(26-15-27-24)23(16-7-3-1-4-8-16)29-22(20)17-11-13-19(14-12-17)28-18-9-5-2-6-10-18/h2,5-6,9-16H,1,3-4,7-8H2,(H2,25,26,27) |
| InChIKey | BTBNAMFPCNQTFA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |