C19H18BrN3O2S — CID 156859704
N-[3-(4-bromo-N-propylanilino)sulfanylphenyl]-1,3-oxazole-2-carboxamide (PubChem CID 156859704) has the molecular formula C19H18BrN3O2S and a molecular weight of 432.34 g/mol. Its IUPAC name is N-[3-(4-bromo-N-propylanilino)sulfanylphenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | N-[3-(4-bromo-N-propylanilino)sulfanylphenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 156859704 |
| Molecular Formula | C19H18BrN3O2S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N-[3-(4-bromo-N-propylanilino)sulfanylphenyl]-1,3-oxazole-2-carboxamide |
| SMILES | CCCN(Sc1cccc(NC(=O)c2ncco2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrN3O2S/c1-2-11-23(16-8-6-14(20)7-9-16)26-17-5-3-4-15(13-17)22-18(24)19-21-10-12-25-19/h3-10,12-13H,2,11H2,1H3,(H,22,24) |
| InChIKey | BESOHZUFCNDSQK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|