C19H16F3N3O2S — CID 156859712
N-[4-ethyl-3-[4-(trifluoromethyl)anilino]sulfanylphenyl]-1,3-oxazole-2-carboxamide (PubChem CID 156859712) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is N-[4-ethyl-3-[4-(trifluoromethyl)anilino]sulfanylphenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | N-[4-ethyl-3-[4-(trifluoromethyl)anilino]sulfanylphenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 156859712 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[4-ethyl-3-[4-(trifluoromethyl)anilino]sulfanylphenyl]-1,3-oxazole-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ncco2)cc1SNc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O2S/c1-2-12-3-6-15(24-17(26)18-23-9-10-27-18)11-16(12)28-25-14-7-4-13(5-8-14)19(20,21)22/h3-11,25H,2H2,1H3,(H,24,26) |
| InChIKey | LMXFOOPCUJAXTK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|