C16H18F3N3O2 — CID 161071740
1,3-oxazole-2-carboxamide;1-[4-(trifluoromethyl)phenyl]piperidine (PubChem CID 161071740) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is 1,3-oxazole-2-carboxamide;1-[4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 1,3-oxazole-2-carboxamide;1-[4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 161071740 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1,3-oxazole-2-carboxamide;1-[4-(trifluoromethyl)phenyl]piperidine |
| SMILES | FC(F)(F)c1ccc(N2CCCCC2)cc1.NC(=O)c1ncco1 |
| InChI | InChI=1S/C12H14F3N.C4H4N2O2/c13-12(14,15)10-4-6-11(7-5-10)16-8-2-1-3-9-16;5-3(7)4-6-1-2-8-4/h4-7H,1-3,8-9H2;1-2H,(H2,5,7) |
| InChIKey | UETCNMJOZDCXHU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |