C22H27FN4O2 — CID 158817229
3-ethyl-1-[3-fluoro-4-[4-[isocyano(1,3-oxazol-2-yl)methyl]piperazin-1-yl]phenyl]pentan-2-one (PubChem CID 158817229) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-ethyl-1-[3-fluoro-4-[4-[isocyano(1,3-oxazol-2-yl)methyl]piperazin-1-yl]phenyl]pentan-2-one.
| Compound Name | 3-ethyl-1-[3-fluoro-4-[4-[isocyano(1,3-oxazol-2-yl)methyl]piperazin-1-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 158817229 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-ethyl-1-[3-fluoro-4-[4-[isocyano(1,3-oxazol-2-yl)methyl]piperazin-1-yl]phenyl]pentan-2-one |
| SMILES | [C-]#[N+]C(c1ncco1)N1CCN(c2ccc(CC(=O)C(CC)CC)cc2F)CC1 |
| InChI | InChI=1S/C22H27FN4O2/c1-4-17(5-2)20(28)15-16-6-7-19(18(23)14-16)26-9-11-27(12-10-26)21(24-3)22-25-8-13-29-22/h6-8,13-14,17,21H,4-5,9-12,15H2,1-2H3 |
| InChIKey | IVKMRROCZKRVCN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|