C25H29FN4O2 — CID 67678555
(2R)-N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-methylbutanamide (PubChem CID 67678555) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is (2R)-N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-methylbutanamide.
| Compound Name | (2R)-N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 67678555 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (2R)-N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(=O)Nc1ccc(N2CCN(C(c3ccccc3)c3ncco3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H29FN4O2/c1-3-18(2)24(31)28-20-9-10-22(21(26)17-20)29-12-14-30(15-13-29)23(25-27-11-16-32-25)19-7-5-4-6-8-19/h4-11,16-18,23H,3,12-15H2,1-2H3,(H,28,31)/t18-,23?/m1/s1 |
| InChIKey | LKNINZSDSYZYAP-FKSKYRLFSA-N |
| XLogP | 4.71 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|