C25H26N4O3S — CID 156859864
N-(4-methoxy-3-sulfanylphenyl)-5-phenyl-1,3-oxazole-2-carboxamide;2,4,6-trimethylpyridin-3-amine (PubChem CID 156859864) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfanylphenyl)-5-phenyl-1,3-oxazole-2-carboxamide;2,4,6-trimethylpyridin-3-amine.
| Compound Name | N-(4-methoxy-3-sulfanylphenyl)-5-phenyl-1,3-oxazole-2-carboxamide;2,4,6-trimethylpyridin-3-amine |
|---|---|
| PubChem CID | 156859864 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-(4-methoxy-3-sulfanylphenyl)-5-phenyl-1,3-oxazole-2-carboxamide;2,4,6-trimethylpyridin-3-amine |
| SMILES | COc1ccc(NC(=O)c2ncc(-c3ccccc3)o2)cc1S.Cc1cc(C)c(N)c(C)n1 |
| InChI | InChI=1S/C17H14N2O3S.C8H12N2/c1-21-13-8-7-12(9-15(13)23)19-16(20)17-18-10-14(22-17)11-5-3-2-4-6-11;1-5-4-6(2)10-7(3)8(5)9/h2-10,23H,1H3,(H,19,20);4H,9H2,1-3H3 |
| InChIKey | ORUQWIOVCKILTP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|