C15H17N3O3 — CID 156862388
tert-butyl N-[(5S,6R)-1-cyano-6-formyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-yl]carbamate (PubChem CID 156862388) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is tert-butyl N-[(5S,6R)-1-cyano-6-formyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5S,6R)-1-cyano-6-formyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 156862388 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | tert-butyl N-[(5S,6R)-1-cyano-6-formyl-6,7-dihydro-5H-cyclopenta[c]pyridin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1c2ccnc(C#N)c2C[C@H]1C=O |
| InChI | InChI=1S/C15H17N3O3/c1-15(2,3)21-14(20)18-13-9(8-19)6-11-10(13)4-5-17-12(11)7-16/h4-5,8-9,13H,6H2,1-3H3,(H,18,20)/t9-,13-/m0/s1 |
| InChIKey | VSMJESIZHHJGCZ-ZANVPECISA-N |
| XLogP | 1.89 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|