C15H16F3N3O2 — CID 156865338
2-[6-[[(2R)-2-hydroxypropyl]amino]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol (PubChem CID 156865338) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-[6-[[(2R)-2-hydroxypropyl]amino]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[6-[[(2R)-2-hydroxypropyl]amino]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 156865338 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[6-[[(2R)-2-hydroxypropyl]amino]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc(NC[C@@H](C)O)nnc1-c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C15H16F3N3O2/c1-8-5-13(19-7-9(2)22)20-21-14(8)11-4-3-10(6-12(11)23)15(16,17)18/h3-6,9,22-23H,7H2,1-2H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | KWBBJWHQLZZWBY-SECBINFHSA-N |
| XLogP | 2.97 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |