C19H24F3N3O2 — CID 178046000
2-[6-[(1R)-5-(dimethylamino)-1-hydroxypentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol (PubChem CID 178046000) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-[6-[(1R)-5-(dimethylamino)-1-hydroxypentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[6-[(1R)-5-(dimethylamino)-1-hydroxypentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 178046000 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[6-[(1R)-5-(dimethylamino)-1-hydroxypentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc([C@H](O)CCCCN(C)C)nnc1-c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C19H24F3N3O2/c1-12-10-15(16(26)6-4-5-9-25(2)3)23-24-18(12)14-8-7-13(11-17(14)27)19(20,21)22/h7-8,10-11,16,26-27H,4-6,9H2,1-3H3/t16-/m1/s1 |
| InChIKey | HGEBZYMRJIEFAG-MRXNPFEDSA-N |
| XLogP | 3.94 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|