C21H30F3N3O — CID 169189956
2-[6-[5-(dimethylamino)pentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol;ethane (PubChem CID 169189956) has the molecular formula C21H30F3N3O and a molecular weight of 397.49 g/mol. Its IUPAC name is 2-[6-[5-(dimethylamino)pentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol;ethane.
| Compound Name | 2-[6-[5-(dimethylamino)pentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol;ethane |
|---|---|
| PubChem CID | 169189956 |
| Molecular Formula | C21H30F3N3O |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[6-[5-(dimethylamino)pentyl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol;ethane |
| SMILES | CC.Cc1cc(CCCCCN(C)C)nnc1-c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C19H24F3N3O.C2H6/c1-13-11-15(7-5-4-6-10-25(2)3)23-24-18(13)16-9-8-14(12-17(16)26)19(20,21)22;1-2/h8-9,11-12,26H,4-7,10H2,1-3H3;1-2H3 |
| InChIKey | GTRDYCUWKHQAHG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|