About N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen
N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen (PubChem CID 156868547) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen.
Molecular Properties
| Compound Name | N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen |
| PubChem CID | 156868547 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen |
| SMILES | CC(C)CNc1ccccc1.CNCc1ccccc1.[H][H].[H][H] |
| InChI | InChI=1S/C10H15N.C8H11N.2H2/c1-9(2)8-11-10-6-4-3-5-7-10;1-9-7-8-5-3-2-4-6-8;;/h3-7,9,11H,8H2,1-2H3;2-6,9H,7H2,1H3;2*1H |
| InChIKey | AWWLLDWBTKAHOV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen?
The IUPAC name of N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen (CID 156868547) is N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen.
What is the SMILES notation for N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen?
The canonical SMILES for N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen is CC(C)CNc1ccccc1.CNCc1ccccc1.[H][H].[H][H].
What is the InChIKey of N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen?
The InChIKey is AWWLLDWBTKAHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C8H11N.2H2/c1-9(2)8-11-10-6-4-3-5-7-10;1-9-7-8-5-3-2-4-6-8;;/h3-7,9,11H,8H2,1-2H3;2-6,9H,7H2,1H3;2*1H.
What are the key properties of N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen?
N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen has a molecular weight of 274.45 g/mol, XLogP of 4.65, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-phenylmethanamine;N-(2-methylpropyl)aniline;molecular hydrogen is sourced from PubChem (CID 156868547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).