C15H25N — CID 167250577
N-(2,3,5-trimethylhexyl)aniline (PubChem CID 167250577) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-(2,3,5-trimethylhexyl)aniline.
| Compound Name | N-(2,3,5-trimethylhexyl)aniline |
|---|---|
| PubChem CID | 167250577 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-(2,3,5-trimethylhexyl)aniline |
| SMILES | CC(C)CC(C)C(C)CNc1ccccc1 |
| InChI | InChI=1S/C15H25N/c1-12(2)10-13(3)14(4)11-16-15-8-6-5-7-9-15/h5-9,12-14,16H,10-11H2,1-4H3 |
| InChIKey | DMHMCFDTSFVOBY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |