C16H37NO3 — CID 156868850
3-(2-aminoethoxy)-3-methylbutan-1-ol;ethane;5-methylhexan-2-one (PubChem CID 156868850) has the molecular formula C16H37NO3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-3-methylbutan-1-ol;ethane;5-methylhexan-2-one.
| Compound Name | 3-(2-aminoethoxy)-3-methylbutan-1-ol;ethane;5-methylhexan-2-one |
|---|---|
| PubChem CID | 156868850 |
| Molecular Formula | C16H37NO3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.28 |
| IUPAC Name | 3-(2-aminoethoxy)-3-methylbutan-1-ol;ethane;5-methylhexan-2-one |
| SMILES | CC.CC(=O)CCC(C)C.CC(C)(CCO)OCCN |
| InChI | InChI=1S/C7H17NO2.C7H14O.C2H6/c1-7(2,3-5-9)10-6-4-8;1-6(2)4-5-7(3)8;1-2/h9H,3-6,8H2,1-2H3;6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | AKLBZZAHEHEFAY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |