C21H42N2O3 — CID 156869090
2-[2-(3-piperidin-1-ylpropoxy)propyl]-4-(3-propan-2-yloxypropyl)morpholine (PubChem CID 156869090) has the molecular formula C21H42N2O3 and a molecular weight of 370.58 g/mol. Its IUPAC name is 2-[2-(3-piperidin-1-ylpropoxy)propyl]-4-(3-propan-2-yloxypropyl)morpholine.
| Compound Name | 2-[2-(3-piperidin-1-ylpropoxy)propyl]-4-(3-propan-2-yloxypropyl)morpholine |
|---|---|
| PubChem CID | 156869090 |
| Molecular Formula | C21H42N2O3 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | 2-[2-(3-piperidin-1-ylpropoxy)propyl]-4-(3-propan-2-yloxypropyl)morpholine |
| SMILES | CC(C)OCCCN1CCOC(CC(C)OCCCN2CCCCC2)C1 |
| InChI | InChI=1S/C21H42N2O3/c1-19(2)24-14-8-12-23-13-16-26-21(18-23)17-20(3)25-15-7-11-22-9-5-4-6-10-22/h19-21H,4-18H2,1-3H3 |
| InChIKey | LGZUQHDXHFSVHF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|