C11H12N2O4 — CID 156869890
2-methyl-7-nitro-3,4-dihydro-1H-isoquinoline-6-carboxylic acid (PubChem CID 156869890) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-methyl-7-nitro-3,4-dihydro-1H-isoquinoline-6-carboxylic acid.
| Compound Name | 2-methyl-7-nitro-3,4-dihydro-1H-isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 156869890 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-methyl-7-nitro-3,4-dihydro-1H-isoquinoline-6-carboxylic acid |
| SMILES | CN1CCc2cc(C(=O)O)c([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C11H12N2O4/c1-12-3-2-7-4-9(11(14)15)10(13(16)17)5-8(7)6-12/h4-5H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | COZHHFGBQMWCMK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|