C24H18N2O4 — CID 156870962
4-[(8-ethynyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide (PubChem CID 156870962) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[(8-ethynyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide.
| Compound Name | 4-[(8-ethynyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide |
|---|---|
| PubChem CID | 156870962 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-[(8-ethynyl-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide |
| SMILES | C#Cc1c(OC(c2ccncc2)c2ccc(C(N)=O)cc2)ccc2c1OCCC2=O |
| InChI | InChI=1S/C24H18N2O4/c1-2-18-21(8-7-19-20(27)11-14-29-23(18)19)30-22(16-9-12-26-13-10-16)15-3-5-17(6-4-15)24(25)28/h1,3-10,12-13,22H,11,14H2,(H2,25,28) |
| InChIKey | XIGBHUZLEJIAIV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|