C15H11F3INO — CID 156872359
3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-5-iodo-2H-furo[2,3-c]pyridine (PubChem CID 156872359) has the molecular formula C15H11F3INO and a molecular weight of 405.16 g/mol. Its IUPAC name is 3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-5-iodo-2H-furo[2,3-c]pyridine.
| Compound Name | 3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-5-iodo-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 156872359 |
| Molecular Formula | C15H11F3INO |
| Molecular Weight | 405.16 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-5-iodo-2H-furo[2,3-c]pyridine |
| SMILES | FCC1(CF)COc2c1cc(I)nc2-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11F3INO/c16-6-15(7-17)8-21-14-11(15)5-12(19)20-13(14)9-1-3-10(18)4-2-9/h1-5H,6-8H2 |
| InChIKey | BRHFHOIIMDQLMF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|