C19H17F4NO2 — CID 164990741
(3R)-3-ethyl-7-(4-fluorophenyl)-3-methyl-5-[(2R)-2-(trifluoromethyl)oxiran-2-yl]-2H-furo[2,3-c]pyridine (PubChem CID 164990741) has the molecular formula C19H17F4NO2 and a molecular weight of 367.34 g/mol. Its IUPAC name is (3R)-3-ethyl-7-(4-fluorophenyl)-3-methyl-5-[(2R)-2-(trifluoromethyl)oxiran-2-yl]-2H-furo[2,3-c]pyridine.
| Compound Name | (3R)-3-ethyl-7-(4-fluorophenyl)-3-methyl-5-[(2R)-2-(trifluoromethyl)oxiran-2-yl]-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 164990741 |
| Molecular Formula | C19H17F4NO2 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (3R)-3-ethyl-7-(4-fluorophenyl)-3-methyl-5-[(2R)-2-(trifluoromethyl)oxiran-2-yl]-2H-furo[2,3-c]pyridine |
| SMILES | CC[C@@]1(C)COc2c1cc([C@]1(C(F)(F)F)CO1)nc2-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17F4NO2/c1-3-17(2)9-25-16-13(17)8-14(18(10-26-18)19(21,22)23)24-15(16)11-4-6-12(20)7-5-11/h4-8H,3,9-10H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | RVEYVMJZVVCIRR-ROUUACIJSA-N |
| XLogP | 4.74 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|