C16H12O3 — CID 156873174
5,6-dimethyl-9-oxoxanthene-4-carbaldehyde (PubChem CID 156873174) has the molecular formula C16H12O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5,6-dimethyl-9-oxoxanthene-4-carbaldehyde.
| Compound Name | 5,6-dimethyl-9-oxoxanthene-4-carbaldehyde |
|---|---|
| PubChem CID | 156873174 |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 5,6-dimethyl-9-oxoxanthene-4-carbaldehyde |
| SMILES | Cc1ccc2c(=O)c3cccc(C=O)c3oc2c1C |
| InChI | InChI=1S/C16H12O3/c1-9-6-7-13-14(18)12-5-3-4-11(8-17)16(12)19-15(13)10(9)2/h3-8H,1-2H3 |
| InChIKey | GHLQJGWEKZQMLB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|