C16H15NO4 — CID 91484908
2-amino-1,3-dihydroxy-4,5,6-trimethylxanthen-9-one (PubChem CID 91484908) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-amino-1,3-dihydroxy-4,5,6-trimethylxanthen-9-one.
| Compound Name | 2-amino-1,3-dihydroxy-4,5,6-trimethylxanthen-9-one |
|---|---|
| PubChem CID | 91484908 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-amino-1,3-dihydroxy-4,5,6-trimethylxanthen-9-one |
| SMILES | Cc1ccc2c(=O)c3c(O)c(N)c(O)c(C)c3oc2c1C |
| InChI | InChI=1S/C16H15NO4/c1-6-4-5-9-13(19)10-14(20)11(17)12(18)8(3)16(10)21-15(9)7(6)2/h4-5,18,20H,17H2,1-3H3 |
| InChIKey | LFQUGXBWEWZNLF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|