C32H44N4O2 — CID 156875041
1-[(4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-6a,6b,9,9,12a-pentamethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-2,1'-cyclopropane]-4a-yl]-2-methylguanidine (PubChem CID 156875041) has the molecular formula C32H44N4O2 and a molecular weight of 516.73 g/mol. Its IUPAC name is 1-[(4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-6a,6b,9,9,12a-pentamethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-2,1'-cyclopropane]-4a-yl]-2-methylguanidine.
| Compound Name | 1-[(4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-6a,6b,9,9,12a-pentamethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-2,1'-cyclopropane]-4a-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 156875041 |
| Molecular Formula | C32H44N4O2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | 1-[(4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-6a,6b,9,9,12a-pentamethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-2,1'-cyclopropane]-4a-yl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@]12CCC3(CC3)C[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H44N4O2/c1-27(2)22-7-8-29(4)23(28(22,3)16-19(18-33)25(27)38)15-21(37)24-20-17-31(10-11-31)12-14-32(20,36-26(34)35-6)13-9-30(24,29)5/h15-16,20,22,24H,7-14,17H2,1-6H3,(H3,34,35,36)/t20-,22-,24-,28-,29+,30+,32+/m0/s1 |
| InChIKey | VBDMUAMQUKHIKE-SGLGIOGWSA-N |
| XLogP | 5.25 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|