C13H16N4OS — CID 156875667
4-[(E)-3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyliminomethyl]-2,5-dihydro-1H-pyrrol-3-amine (PubChem CID 156875667) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-[(E)-3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyliminomethyl]-2,5-dihydro-1H-pyrrol-3-amine.
| Compound Name | 4-[(E)-3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyliminomethyl]-2,5-dihydro-1H-pyrrol-3-amine |
|---|---|
| PubChem CID | 156875667 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-[(E)-3,4-dihydro-2H-1,4-benzoxazin-6-ylsulfanyliminomethyl]-2,5-dihydro-1H-pyrrol-3-amine |
| SMILES | NC1=C(/C=N/Sc2ccc3c(c2)NCCO3)CNC1 |
| InChI | InChI=1S/C13H16N4OS/c14-11-8-15-6-9(11)7-17-19-10-1-2-13-12(5-10)16-3-4-18-13/h1-2,5,7,15-16H,3-4,6,8,14H2/b17-7+ |
| InChIKey | XIGUHGOPHZCIAR-REZTVBANSA-N |
| XLogP | 1.38 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|