C8H16N2 — CID 156877119
2,5-diethyl-3-methyl-1,5-dihydropyrazole (PubChem CID 156877119) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,5-diethyl-3-methyl-1,5-dihydropyrazole.
| Compound Name | 2,5-diethyl-3-methyl-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 156877119 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2,5-diethyl-3-methyl-1,5-dihydropyrazole |
| SMILES | CCC1C=C(C)N(CC)N1 |
| InChI | InChI=1S/C8H16N2/c1-4-8-6-7(3)10(5-2)9-8/h6,8-9H,4-5H2,1-3H3 |
| InChIKey | LINYETUSRBYGGN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |