C15H10FN3O — CID 156877289
2-amino-1-(4-fluorophenyl)-5-hydroxyindole-3-carbonitrile (PubChem CID 156877289) has the molecular formula C15H10FN3O and a molecular weight of 267.26 g/mol. Its IUPAC name is 2-amino-1-(4-fluorophenyl)-5-hydroxyindole-3-carbonitrile.
| Compound Name | 2-amino-1-(4-fluorophenyl)-5-hydroxyindole-3-carbonitrile |
|---|---|
| PubChem CID | 156877289 |
| Molecular Formula | C15H10FN3O |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-amino-1-(4-fluorophenyl)-5-hydroxyindole-3-carbonitrile |
| SMILES | N#Cc1c(N)n(-c2ccc(F)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C15H10FN3O/c16-9-1-3-10(4-2-9)19-14-6-5-11(20)7-12(14)13(8-17)15(19)18/h1-7,20H,18H2 |
| InChIKey | XFEQFUVTVWBRQP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |