C24H38FNO3 — CID 156877850
ethane;[(3E,5Z)-2-(hydroxyamino)-5-propan-2-ylhepta-1,3,5-trien-3-yl] 3-fluoro-4-methylbenzoate;2-methylpropane (PubChem CID 156877850) has the molecular formula C24H38FNO3 and a molecular weight of 407.57 g/mol. Its IUPAC name is ethane;[(3E,5Z)-2-(hydroxyamino)-5-propan-2-ylhepta-1,3,5-trien-3-yl] 3-fluoro-4-methylbenzoate;2-methylpropane.
| Compound Name | ethane;[(3E,5Z)-2-(hydroxyamino)-5-propan-2-ylhepta-1,3,5-trien-3-yl] 3-fluoro-4-methylbenzoate;2-methylpropane |
|---|---|
| PubChem CID | 156877850 |
| Molecular Formula | C24H38FNO3 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | ethane;[(3E,5Z)-2-(hydroxyamino)-5-propan-2-ylhepta-1,3,5-trien-3-yl] 3-fluoro-4-methylbenzoate;2-methylpropane |
| SMILES | C=C(NO)/C(=C\C(=C/C)C(C)C)OC(=O)c1ccc(C)c(F)c1.CC.CC(C)C |
| InChI | InChI=1S/C18H22FNO3.C4H10.C2H6/c1-6-14(11(2)3)10-17(13(5)20-22)23-18(21)15-8-7-12(4)16(19)9-15;1-4(2)3;1-2/h6-11,20,22H,5H2,1-4H3;4H,1-3H3;1-2H3/b14-6+,17-10+;; |
| InChIKey | JUIPOOPNAIXKJQ-NRNZJINJSA-N |
| XLogP | 6.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|