C19H33NO2 — CID 156878214
ethane;(3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one (PubChem CID 156878214) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is ethane;(3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one.
| Compound Name | ethane;(3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 156878214 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | ethane;(3Z,5Z)-5-ethyl-1-[4-(2-hydroxyethyl)piperidin-1-yl]-2-methylidenehepta-3,5-dien-1-one |
| SMILES | C=C(/C=C\C(=C/C)CC)C(=O)N1CCC(CCO)CC1.CC |
| InChI | InChI=1S/C17H27NO2.C2H6/c1-4-15(5-2)7-6-14(3)17(20)18-11-8-16(9-12-18)10-13-19;1-2/h4,6-7,16,19H,3,5,8-13H2,1-2H3;1-2H3/b7-6-,15-4-; |
| InChIKey | DUEAXZOLKDBNIM-JESLTXAHSA-N |
| XLogP | 4.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|