C27H41NO2 — CID 56666396
(2E,4E,6E,8E)-1-[4-(2-hydroxyethyl)piperidin-1-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 56666396) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is (2E,4E,6E,8E)-1-[4-(2-hydroxyethyl)piperidin-1-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4E,6E,8E)-1-[4-(2-hydroxyethyl)piperidin-1-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 56666396 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | (2E,4E,6E,8E)-1-[4-(2-hydroxyethyl)piperidin-1-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)N2CCC(CCO)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C27H41NO2/c1-21(11-12-25-23(3)10-7-16-27(25,4)5)8-6-9-22(2)20-26(30)28-17-13-24(14-18-28)15-19-29/h6,8-9,11-12,20,24,29H,7,10,13-19H2,1-5H3/b9-6+,12-11+,21-8+,22-20+ |
| InChIKey | ODRSNVLBJMIFFC-XGOOJIEDSA-N |
| XLogP | 6.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|