About 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene
4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene (PubChem CID 156878754) has the molecular formula C22H19BrF3NO2
and a molecular weight of 466.30 g/mol. Its IUPAC name is 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene.
Molecular Properties
| Compound Name | 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene |
| PubChem CID | 156878754 |
| Molecular Formula | C22H19BrF3NO2 |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene |
| SMILES | CC.Fc1ccc(-n2ccc3c(Br)cc(F)cc32)cc1.OOc1ccc(F)cc1 |
| InChI | InChI=1S/C14H8BrF2N.C6H5FO2.C2H6/c15-13-7-10(17)8-14-12(13)5-6-18(14)11-3-1-9(16)2-4-11;7-5-1-3-6(9-8)4-2-5;1-2/h1-8H;1-4,8H;1-2H3 |
| InChIKey | KACRJJDGEUDUCK-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene?
The IUPAC name of 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene (CID 156878754) is 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene.
What is the SMILES notation for 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene?
The canonical SMILES for 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene is CC.Fc1ccc(-n2ccc3c(Br)cc(F)cc32)cc1.OOc1ccc(F)cc1.
What is the InChIKey of 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene?
The InChIKey is KACRJJDGEUDUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrF2N.C6H5FO2.C2H6/c15-13-7-10(17)8-14-12(13)5-6-18(14)11-3-1-9(16)2-4-11;7-5-1-3-6(9-8)4-2-5;1-2/h1-8H;1-4,8H;1-2H3.
What are the key properties of 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene?
4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene has a molecular weight of 466.30 g/mol, XLogP of 7.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-fluoro-1-(4-fluorophenyl)indole;ethane;1-fluoro-4-hydroperoxybenzene is sourced from PubChem (CID 156878754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).