C21H18ClNO3 — CID 156880239
4-chloro-3-(3,6-dihydro-2H-pyran-4-yl)-1-oxido-7-phenylmethoxyquinolin-1-ium (PubChem CID 156880239) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is 4-chloro-3-(3,6-dihydro-2H-pyran-4-yl)-1-oxido-7-phenylmethoxyquinolin-1-ium.
| Compound Name | 4-chloro-3-(3,6-dihydro-2H-pyran-4-yl)-1-oxido-7-phenylmethoxyquinolin-1-ium |
|---|---|
| PubChem CID | 156880239 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-chloro-3-(3,6-dihydro-2H-pyran-4-yl)-1-oxido-7-phenylmethoxyquinolin-1-ium |
| SMILES | [O-][n+]1cc(C2=CCOCC2)c(Cl)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C21H18ClNO3/c22-21-18-7-6-17(26-14-15-4-2-1-3-5-15)12-20(18)23(24)13-19(21)16-8-10-25-11-9-16/h1-8,12-13H,9-11,14H2 |
| InChIKey | ZNSSZKWVMLFFII-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|