C19H16N2O2S — CID 67393090
2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium (PubChem CID 67393090) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium.
| Compound Name | 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium |
|---|---|
| PubChem CID | 67393090 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium |
| SMILES | CCc1nc2c[n+]([O-])c3cc(OCc4ccccc4)ccc3c2s1 |
| InChI | InChI=1S/C19H16N2O2S/c1-2-18-20-16-11-21(22)17-10-14(8-9-15(17)19(16)24-18)23-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 |
| InChIKey | AOKKHNQKXUYEPL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|