About 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium
2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium (PubChem CID 67393090) has the molecular formula C19H16N2O2S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium.
Molecular Properties
| Compound Name | 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium |
| PubChem CID | 67393090 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium |
| SMILES | CCc1nc2c[n+]([O-])c3cc(OCc4ccccc4)ccc3c2s1 |
| InChI | InChI=1S/C19H16N2O2S/c1-2-18-20-16-11-21(22)17-10-14(8-9-15(17)19(16)24-18)23-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 |
| InChIKey | AOKKHNQKXUYEPL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium?
The IUPAC name of 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium (CID 67393090) is 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium.
What is the SMILES notation for 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium?
The canonical SMILES for 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium is CCc1nc2c[n+]([O-])c3cc(OCc4ccccc4)ccc3c2s1.
What is the InChIKey of 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium?
The InChIKey is AOKKHNQKXUYEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2S/c1-2-18-20-16-11-21(22)17-10-14(8-9-15(17)19(16)24-18)23-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3.
What are the key properties of 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium?
2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium has a molecular weight of 336.42 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-oxido-7-phenylmethoxy-[1,3]thiazolo[4,5-c]quinolin-5-ium is sourced from PubChem (CID 67393090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).