C20H26N3O4S+ — CID 69306045
6-[(5-hydroxy-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]hexylcarbamic acid (PubChem CID 69306045) has the molecular formula C20H26N3O4S+ and a molecular weight of 404.51 g/mol. Its IUPAC name is 6-[(5-hydroxy-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]hexylcarbamic acid.
| Compound Name | 6-[(5-hydroxy-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]hexylcarbamic acid |
|---|---|
| PubChem CID | 69306045 |
| Molecular Formula | C20H26N3O4S+ |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 6-[(5-hydroxy-2-propyl-[1,3]thiazolo[4,5-c]quinolin-5-ium-7-yl)oxy]hexylcarbamic acid |
| SMILES | CCCc1nc2c[n+](O)c3cc(OCCCCCCNC(=O)O)ccc3c2s1 |
| InChI | InChI=1S/C20H25N3O4S/c1-2-7-18-22-16-13-23(26)17-12-14(8-9-15(17)19(16)28-18)27-11-6-4-3-5-10-21-20(24)25/h8-9,12-13,21H,2-7,10-11H2,1H3,(H-,24,25,26)/p+1 |
| InChIKey | WOIDSKATRHXUGG-UHFFFAOYSA-O |
| XLogP | 4.13 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|