C20H19FN2O4 — CID 156880383
2-[3-(dimethylamino)-4-(4-fluorophenyl)-7-methoxyisoquinolin-1-yl]oxyacetic acid (PubChem CID 156880383) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-4-(4-fluorophenyl)-7-methoxyisoquinolin-1-yl]oxyacetic acid.
| Compound Name | 2-[3-(dimethylamino)-4-(4-fluorophenyl)-7-methoxyisoquinolin-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 156880383 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[3-(dimethylamino)-4-(4-fluorophenyl)-7-methoxyisoquinolin-1-yl]oxyacetic acid |
| SMILES | COc1ccc2c(-c3ccc(F)cc3)c(N(C)C)nc(OCC(=O)O)c2c1 |
| InChI | InChI=1S/C20H19FN2O4/c1-23(2)19-18(12-4-6-13(21)7-5-12)15-9-8-14(26-3)10-16(15)20(22-19)27-11-17(24)25/h4-10H,11H2,1-3H3,(H,24,25) |
| InChIKey | LLGJWKMTWREFDF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |