C27H34N8O3Si — CID 156880932
N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]-5-(methylcarbamoyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)indazole-6-carboxamide (PubChem CID 156880932) has the molecular formula C27H34N8O3Si and a molecular weight of 546.71 g/mol. Its IUPAC name is N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]-5-(methylcarbamoyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)indazole-6-carboxamide.
| Compound Name | N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]-5-(methylcarbamoyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 156880932 |
| Molecular Formula | C27H34N8O3Si |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | N-[2-[(2,6-dimethylpyrimidin-4-yl)amino]-5-(methylcarbamoyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)indazole-6-carboxamide |
| SMILES | CNC(=O)c1cnc(Nc2cc(C)nc(C)n2)cc1NC(=O)c1ccc2cn(COCC[Si](C)(C)C)nc2c1 |
| InChI | InChI=1S/C27H34N8O3Si/c1-17-11-25(31-18(2)30-17)33-24-13-23(21(14-29-24)27(37)28-3)32-26(36)19-7-8-20-15-35(34-22(20)12-19)16-38-9-10-39(4,5)6/h7-8,11-15H,9-10,16H2,1-6H3,(H,28,37)(H2,29,30,31,32,33,36) |
| InChIKey | SPXAUVRDKUSYHC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|