C14H13N5O — CID 67997917
2-methyl-N-(5-methylpyrazin-2-yl)indazole-6-carboxamide (PubChem CID 67997917) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-methyl-N-(5-methylpyrazin-2-yl)indazole-6-carboxamide.
| Compound Name | 2-methyl-N-(5-methylpyrazin-2-yl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 67997917 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-methyl-N-(5-methylpyrazin-2-yl)indazole-6-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2ccc3cn(C)nc3c2)cn1 |
| InChI | InChI=1S/C14H13N5O/c1-9-6-16-13(7-15-9)17-14(20)10-3-4-11-8-19(2)18-12(11)5-10/h3-8H,1-2H3,(H,16,17,20) |
| InChIKey | WQQDMBUHTRCAMQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |