C21H20N6O4S — CID 58574099
2-ethyl-N-(5-methylpyrazin-2-yl)-4-(4-sulfamoylphenoxy)indazole-6-carboxamide (PubChem CID 58574099) has the molecular formula C21H20N6O4S and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-ethyl-N-(5-methylpyrazin-2-yl)-4-(4-sulfamoylphenoxy)indazole-6-carboxamide.
| Compound Name | 2-ethyl-N-(5-methylpyrazin-2-yl)-4-(4-sulfamoylphenoxy)indazole-6-carboxamide |
|---|---|
| PubChem CID | 58574099 |
| Molecular Formula | C21H20N6O4S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-ethyl-N-(5-methylpyrazin-2-yl)-4-(4-sulfamoylphenoxy)indazole-6-carboxamide |
| SMILES | CCn1cc2c(Oc3ccc(S(N)(=O)=O)cc3)cc(C(=O)Nc3cnc(C)cn3)cc2n1 |
| InChI | InChI=1S/C21H20N6O4S/c1-3-27-12-17-18(26-27)8-14(21(28)25-20-11-23-13(2)10-24-20)9-19(17)31-15-4-6-16(7-5-15)32(22,29)30/h4-12H,3H2,1-2H3,(H2,22,29,30)(H,24,25,28) |
| InChIKey | KUXABOCDNUPWEL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |