C26H27N3O5S — CID 70683488
3-(4-cyclopropylsulfonylphenoxy)-5-(3-methylbut-2-enoxy)-N-(5-methylpyrazin-2-yl)benzamide (PubChem CID 70683488) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is 3-(4-cyclopropylsulfonylphenoxy)-5-(3-methylbut-2-enoxy)-N-(5-methylpyrazin-2-yl)benzamide.
| Compound Name | 3-(4-cyclopropylsulfonylphenoxy)-5-(3-methylbut-2-enoxy)-N-(5-methylpyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 70683488 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 3-(4-cyclopropylsulfonylphenoxy)-5-(3-methylbut-2-enoxy)-N-(5-methylpyrazin-2-yl)benzamide |
| SMILES | CC(C)=CCOc1cc(Oc2ccc(S(=O)(=O)C3CC3)cc2)cc(C(=O)Nc2cnc(C)cn2)c1 |
| InChI | InChI=1S/C26H27N3O5S/c1-17(2)10-11-33-21-12-19(26(30)29-25-16-27-18(3)15-28-25)13-22(14-21)34-20-4-6-23(7-5-20)35(31,32)24-8-9-24/h4-7,10,12-16,24H,8-9,11H2,1-3H3,(H,28,29,30) |
| InChIKey | HCOXEGAMJSNLLP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|