C27H31N3O6S2 — CID 70689789
3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 70689789) has the molecular formula C27H31N3O6S2 and a molecular weight of 557.69 g/mol. Its IUPAC name is 3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 70689789 |
| Molecular Formula | C27H31N3O6S2 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COC1CCN(S(=O)(=O)c2ccc(Oc3cc(OCC=C(C)C)cc(C(=O)Nc4nccs4)c3)cc2)CC1 |
| InChI | InChI=1S/C27H31N3O6S2/c1-19(2)10-14-35-23-16-20(26(31)29-27-28-11-15-37-27)17-24(18-23)36-22-4-6-25(7-5-22)38(32,33)30-12-8-21(34-3)9-13-30/h4-7,10-11,15-18,21H,8-9,12-14H2,1-3H3,(H,28,29,31) |
| InChIKey | RSQVANLBVQMPIA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|