C15H17N3O4S2 — CID 122152547
4-(3-hydroxypiperidin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 122152547) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-(3-hydroxypiperidin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(3-hydroxypiperidin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 122152547 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-(3-hydroxypiperidin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(S(=O)(=O)N2CCCC(O)C2)cc1 |
| InChI | InChI=1S/C15H17N3O4S2/c19-12-2-1-8-18(10-12)24(21,22)13-5-3-11(4-6-13)14(20)17-15-16-7-9-23-15/h3-7,9,12,19H,1-2,8,10H2,(H,16,17,20) |
| InChIKey | ZCRGKEOKNAQYCE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |