C14H18F2N2O4S — CID 97139801
N-(2,2-difluoroethyl)-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzamide (PubChem CID 97139801) has the molecular formula C14H18F2N2O4S and a molecular weight of 348.37 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-(2,2-difluoroethyl)-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 97139801 |
| Molecular Formula | C14H18F2N2O4S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-[(3S)-3-hydroxypiperidin-1-yl]sulfonylbenzamide |
| SMILES | O=C(NCC(F)F)c1ccc(S(=O)(=O)N2CCC[C@H](O)C2)cc1 |
| InChI | InChI=1S/C14H18F2N2O4S/c15-13(16)8-17-14(20)10-3-5-12(6-4-10)23(21,22)18-7-1-2-11(19)9-18/h3-6,11,13,19H,1-2,7-9H2,(H,17,20)/t11-/m0/s1 |
| InChIKey | PNXWTEJGPQFIRS-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |