C20H28F3N3O3S — CID 86900559
4-[3-(azepan-1-yl)piperidin-1-yl]sulfonyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 86900559) has the molecular formula C20H28F3N3O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is 4-[3-(azepan-1-yl)piperidin-1-yl]sulfonyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[3-(azepan-1-yl)piperidin-1-yl]sulfonyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 86900559 |
| Molecular Formula | C20H28F3N3O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[3-(azepan-1-yl)piperidin-1-yl]sulfonyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(S(=O)(=O)N2CCCC(N3CCCCCC3)C2)cc1 |
| InChI | InChI=1S/C20H28F3N3O3S/c21-20(22,23)15-24-19(27)16-7-9-18(10-8-16)30(28,29)26-13-5-6-17(14-26)25-11-3-1-2-4-12-25/h7-10,17H,1-6,11-15H2,(H,24,27) |
| InChIKey | LTLGHRXKNINQGW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |