C21H19N7O3 — CID 58574075
4-(5-carbamoylpyrazin-2-yl)oxy-2-ethyl-N-(5-methyl-2-pyridinyl)indazole-6-carboxamide (PubChem CID 58574075) has the molecular formula C21H19N7O3 and a molecular weight of 417.43 g/mol. Its IUPAC name is 4-(5-carbamoylpyrazin-2-yl)oxy-2-ethyl-N-(5-methyl-2-pyridinyl)indazole-6-carboxamide.
| Compound Name | 4-(5-carbamoylpyrazin-2-yl)oxy-2-ethyl-N-(5-methyl-2-pyridinyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 58574075 |
| Molecular Formula | C21H19N7O3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-(5-carbamoylpyrazin-2-yl)oxy-2-ethyl-N-(5-methyl-2-pyridinyl)indazole-6-carboxamide |
| SMILES | CCn1cc2c(Oc3cnc(C(N)=O)cn3)cc(C(=O)Nc3ccc(C)cn3)cc2n1 |
| InChI | InChI=1S/C21H19N7O3/c1-3-28-11-14-15(27-28)6-13(21(30)26-18-5-4-12(2)8-24-18)7-17(14)31-19-10-23-16(9-25-19)20(22)29/h4-11H,3H2,1-2H3,(H2,22,29)(H,24,26,30) |
| InChIKey | ILPZGDXAEOASKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |