C17H19N5O5S — CID 58574041
ethyl 2-ethyl-4-[5-(methanesulfonamido)pyrazin-2-yl]oxyindazole-6-carboxylate (PubChem CID 58574041) has the molecular formula C17H19N5O5S and a molecular weight of 405.44 g/mol. Its IUPAC name is ethyl 2-ethyl-4-[5-(methanesulfonamido)pyrazin-2-yl]oxyindazole-6-carboxylate.
| Compound Name | ethyl 2-ethyl-4-[5-(methanesulfonamido)pyrazin-2-yl]oxyindazole-6-carboxylate |
|---|---|
| PubChem CID | 58574041 |
| Molecular Formula | C17H19N5O5S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | ethyl 2-ethyl-4-[5-(methanesulfonamido)pyrazin-2-yl]oxyindazole-6-carboxylate |
| SMILES | CCOC(=O)c1cc(Oc2cnc(NS(C)(=O)=O)cn2)c2cn(CC)nc2c1 |
| InChI | InChI=1S/C17H19N5O5S/c1-4-22-10-12-13(20-22)6-11(17(23)26-5-2)7-14(12)27-16-9-18-15(8-19-16)21-28(3,24)25/h6-10H,4-5H2,1-3H3,(H,18,21) |
| InChIKey | PHBJPHASUUIULG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |